On Target FYN_HUMAN 0.35714287/CHEMBL1975923
For the given ligand CBDCOOH, we have found in our database that, being scored 0.35714287, the most similar ligand is CHEMBL1975923. Check out the elaboration below.
| CBDCOOH (Given Ligand) | CHEMBL1975923 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C(=O)O)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | CC(CCC(=O)O)(c1ccc(O)c(N)c1)c2ccc(O)c(N)c2 |
|
|
|
|
|
|
| 00010001 43000008 20000102 00010202 00090000 40800000 02000081 08000602 01040900 00980842 08100000 40409840 0402800a 00a00000 00000400 00082008 00000000 02100020 00612010 00020a01 00000100 08000a80 01008000 00400010 00201000 84004400 04404200 80000000 00000002 00024002 24020000 00010400 | 08010002 01000008 20000102 00010200 00080000 00000000 02000000 01000000 00400800 00080840 08100004 40009000 04008002 00200800 00000040 00084008 00000000 02000000 00400000 00020001 40000100 08000a00 21000000 00400010 00040000 a0000000 00120000 40000000 00400080 00060002 00000000 00400400 |