On Target CDK5_HUMAN 0.29777777/CHEMBL1966703
For the given ligand CBDCOOH, we have found in our database that, being scored 0.29777777, the most similar ligand is CHEMBL1966703. Check out the elaboration below.
| CBDCOOH (Given Ligand) | CHEMBL1966703 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C(=O)O)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | Cc1n[nH]c2NC3=C(C(c4ccccc4F)c12)C(=O)CC(C)(C)C3 |
|
|
|
|
|
|
| 00010001 43000008 20000102 00010202 00090000 40800000 02000081 08000602 01040900 00980842 08100000 40409840 0402800a 00a00000 00000400 00082008 00000000 02100020 00612010 00020a01 00000100 08000a80 01008000 00400010 00201000 84004400 04404200 80000000 00000002 00024002 24020000 00010400 | 00410083 43200409 60100182 02c10610 21000363 60982052 43802481 01000402 81000c00 189888d0 08380000 c041b000 0402c030 00201000 00c31c20 0004e00e 01058201 03108023 00e32208 00220801 08110182 18100690 2080c800 10528090 00241800 80008001 20564010 d18411c1 8208008e 00068202 04028480 60000660 |