On Target ESR1_HUMAN 0.552/CHEMBL211493
For the given ligand CBDCOOH, we have found in our database that, being scored 0.552, the most similar ligand is CHEMBL211493. Check out the elaboration below.
| CBDCOOH (Given Ligand) | CHEMBL211493 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C(=O)O)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | CC1=C2c3ccc(O)cc3CC2(CCC1=O)c4ccccc4 |
|
|
|
|
|
|
| 00010001 43000008 20000102 00010202 00090000 40800000 02000081 08000602 01040900 00980842 08100000 40409840 0402800a 00a00000 00000400 00082008 00000000 02100020 00612010 00020a01 00000100 08000a80 01008000 00400010 00201000 84004400 04404200 80000000 00000002 00024002 24020000 00010400 | 10090000 43000008 20000302 00110200 22000000 40802000 82000081 00000402 01800800 00988842 08100000 40009000 0402800a 00201000 00000422 0002000a 00000400 02100020 0021a000 00020a01 00100100 08100280 0040c021 00400010 01200000 84000001 00526000 c0000000 00400002 00020002 24020000 00410500 |