On Target PTGES_HUMAN 0.6666667/CHEMBL3608370
For the given ligand CBDCOOH, we have found in our database that, being scored 0.6666667, the most similar ligand is CHEMBL3608370. Check out the elaboration below.
| CBDCOOH (Given Ligand) | CHEMBL3608370 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C(=O)O)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | CC(C)C(C1=C(O)CC(C)(C)CC1=O)c2c(O)c(C(C(C)C)C3=C(O)CC(C)(C)CC3=O)c(O)c(C(C(C)C)C4=C(O)CC(C)(C)CC4=O)c2O |
|
|
|
|
|
|
| 00010001 43000008 20000102 00010202 00090000 40800000 02000081 08000602 01040900 00980842 08100000 40409840 0402800a 00a00000 00000400 00082008 00000000 02100020 00612010 00020a01 00000100 08000a80 01008000 00400010 00201000 84004400 04404200 80000000 00000002 00024002 24020000 00010400 | 00010001 01000008 20000102 0001020a 00080001 00800000 06000081 00000602 01040800 00988840 08100000 40009040 84028022 00a00000 00000400 00082008 00000400 02100020 00652008 00020801 00000100 18000280 01008000 00400010 00200800 80000000 00524000 80800000 00004002 00024002 04020000 00000400 |