On Target PERM_HUMAN 0.4065934/CHEMBL3920217
For the given ligand CBD, we have found in our database that, being scored 0.4065934, the most similar ligand is CHEMBL3920217. Check out the elaboration below.
| CBD (Given Ligand) | CHEMBL3920217 (Similar Ligand) |
|---|---|
| C=C(C)C1CC/C(C)=C\C1c2c(O)cc(CCCCC)cc2O | Oc1ccccc1CCCNCc2ccccc2O |
|
|
|
|
|
|
| 00000001 43000008 20000102 00010202 00010000 40800000 02000001 00000602 00040900 00980842 08100000 40408840 00020002 00200000 00000400 00002008 00000000 02100020 00202000 00020a01 00000100 08000000 00008000 00400010 00200000 80000000 04404200 80000000 00000002 00024002 24020000 00010400 | 00000000 00000208 20100100 00010600 00000000 00000000 02000000 22001600 00000800 001808c0 08300000 40008040 00000802 00000000 00000400 00042008 00000000 02000000 00000000 00020201 00000100 18008000 00000000 00400010 00000000 c0000000 00000000 90000000 00000100 0006800a 24040000 00000600 |