On Target PDE5A_HUMAN 0.27329192/CHEMBL193059
For the given ligand CBD, we have found in our database that, being scored 0.27329192, the most similar ligand is CHEMBL193059. Check out the elaboration below.
| CBD (Given Ligand) | CHEMBL193059 (Similar Ligand) |
|---|---|
| C=C(C)C1CC/C(C)=C\C1c2c(O)cc(CCCCC)cc2O | CC(=CCc1c(O)cc(O)c2C(=O)C(=C(Oc12)c3ccc(O)c(O)c3)O)C |
|
|
|
|
|
|
| 00000001 43000008 20000102 00010202 00010000 40800000 02000001 00000602 00040900 00980842 08100000 40408840 00020002 00200000 00000400 00002008 00000000 02100020 00202000 00020a01 00000100 08000000 00008000 00400010 00200000 80000000 04404200 80000000 00000002 00024002 24020000 00010400 | 00402001 40200018 200a0100 04110202 0001020d 80804120 02000001 40800600 020e4100 40980840 08000091 41008000 40008412 00200088 00000020 1000a208 00064060 02100840 0e000200 00821a00 00240000 0810082a 1000c000 00584010 08400200 80004001 145a00b4 0a900040 00006200 01820802 45000240 00000400 |