On Target CASP1_HUMAN 0.26548672/CHEMBL466565
For the given ligand CBD, we have found in our database that, being scored 0.26548672, the most similar ligand is CHEMBL466565. Check out the elaboration below.
| CBD (Given Ligand) | CHEMBL466565 (Similar Ligand) |
|---|---|
| C=C(C)C1CC/C(C)=C\C1c2c(O)cc(CCCCC)cc2O | CC(C)C[C@H]1C[C@H]([C@@H](O)CC(=O)Cc2ccccc2)C(=O)N1 |
|
|
|
|
|
|
| 00000001 43000008 20000102 00010202 00010000 40800000 02000001 00000602 00040900 00980842 08100000 40408840 00020002 00200000 00000400 00002008 00000000 02100020 00202000 00020a01 00000100 08000000 00008000 00400010 00200000 80000000 04404200 80000000 00000002 00024002 24020000 00010400 | 00030000 01001000 00100102 00010600 00180000 00000010 00000000 20000000 00000800 000a08c0 08300000 40019000 1500801a 00a00000 40000000 00080008 00000000 02000000 00c02000 00000201 00000100 18040610 01000080 00500018 00000001 80000000 00000000 10000000 00000002 00060003 00022000 00002e00 |