On Target CHLE_HUMAN 0.40186915/CHEMBL3586200
For the given ligand CBD, we have found in our database that, being scored 0.40186915, the most similar ligand is CHEMBL3586200. Check out the elaboration below.
| CBD (Given Ligand) | CHEMBL3586200 (Similar Ligand) |
|---|---|
| C=C(C)C1CC/C(C)=C\C1c2c(O)cc(CCCCC)cc2O | C[C@@]12CC[C@@H]3[C@](C)(CC[C@H](OC(=O)CCc4ccc(O)cc4)[C@]3(C)C(=O)O)[C@H]1CC[C@H]5C(=CC[C@H]6[C@@](C)(CO)[C@H](O)CC[C@]56C)C2 |
|
|
|
|
|
|
| 00000001 43000008 20000102 00010202 00010000 40800000 02000001 00000602 00040900 00980842 08100000 40408840 00020002 00200000 00000400 00002008 00000000 02100020 00202000 00020a01 00000100 08000000 00008000 00400010 00200000 80000000 04404200 80000000 00000002 00024002 24020000 00010400 | 00010040 01000008 20000100 00010300 000c0040 00200000 02000000 00000402 00000800 01180848 08100000 40009000 1402800a 00800000 00000400 00081008 00820000 02000020 03402008 00020001 00000120 08000a00 01008040 00400010 00200c00 80000000 0052c000 80001000 00000200 0002000a 24020000 00000400 |