On Target NEP_HUMAN 0.29807693/CHEMBL4070297
For the given ligand CBD, we have found in our database that, being scored 0.29807693, the most similar ligand is CHEMBL4070297. Check out the elaboration below.
| CBD (Given Ligand) | CHEMBL4070297 (Similar Ligand) |
|---|---|
| C=C(C)C1CC/C(C)=C\C1c2c(O)cc(CCCCC)cc2O | OC(=O)[C@@H](CC(=O)C1(S)CCCCC1)Cc2ccc(cc2)c3ccccc3 |
|
|
|
|
|
|
| 00000001 43000008 20000102 00010202 00010000 40800000 02000001 00000602 00040900 00980842 08100000 40408840 00020002 00200000 00000400 00002008 00000000 02100020 00202000 00020a01 00000100 08000000 00008000 00400010 00200000 80000000 04404200 80000000 00000002 00024002 24020000 00010400 | 00052000 01000000 00000102 00110200 00080008 00000000 00000000 00000000 00a00900 00080840 08100000 40029800 04008008 00a40000 00000000 00080008 00020000 02000000 06402008 10000001 00000100 08000a00 11000140 00400010 00000800 80000000 00000000 00000040 00004002 00020002 00020000 01410400 |