On Target NOS1_HUMAN 0.2857143/CHEMBL85613
For the given ligand CBD, we have found in our database that, being scored 0.2857143, the most similar ligand is CHEMBL85613. Check out the elaboration below.
| CBD (Given Ligand) | CHEMBL85613 (Similar Ligand) |
|---|---|
| C=C(C)C1CC/C(C)=C\C1c2c(O)cc(CCCCC)cc2O | COc1ccc2N=C(N)[C@@H]3CCC[C@@H]3c2c1 |
|
|
|
|
|
|
| 00000001 43000008 20000102 00010202 00010000 40800000 02000001 00000602 00040900 00980842 08100000 40408840 00020002 00200000 00000400 00002008 00000000 02100020 00202000 00020a01 00000100 08000000 00008000 00400010 00200000 80000000 04404200 80000000 00000002 00024002 24020000 00010400 | 00000002 43200208 2000010a 00010e20 00001000 40200000 13000010 00002008 00000800 000a08c3 08110004 40018000 10001002 60200008 010200c1 00000008 00000800 02000000 01082008 10020201 40000101 18010110 20000000 00400810 00090000 88100001 40040400 00000800 00080202 0186000a 000a0000 20100500 |