On Target PGH1_SHEEP 0.40495867/CHEMBL229957
For the given ligand CBD, we have found in our database that, being scored 0.40495867, the most similar ligand is CHEMBL229957. Check out the elaboration below.
| CBD (Given Ligand) | CHEMBL229957 (Similar Ligand) |
|---|---|
| C=C(C)C1CC/C(C)=C\C1c2c(O)cc(CCCCC)cc2O | COc1ccc2C=C(CCc2c1)c3ccc(OC)c(OC)c3OC |
|
|
|
|
|
|
| 00000001 43000008 20000102 00010202 00010000 40800000 02000001 00000602 00040900 00980842 08100000 40408840 00020002 00200000 00000400 00002008 00000000 02100020 00202000 00020a01 00000100 08000000 00008000 00400010 00200000 80000000 04404200 80000000 00000002 00024002 24020000 00010400 | 00080001 43000008 2000030a 00110200 20201000 40040000 c2040080 00000600 00000804 00180842 08102100 40108040 00024002 20200000 01000023 0002a00a 04000400 02000004 10080000 00020a01 00100100 18000000 0000c021 00400410 01000000 c0000001 00522000 c0000000 00400300 0002410b 04000000 00010500 |