On Target P2Y12_HUMAN 0.2260274/CHEMBL88799
For the given ligand CBD, we have found in our database that, being scored 0.2260274, the most similar ligand is CHEMBL88799. Check out the elaboration below.
| CBD (Given Ligand) | CHEMBL88799 (Similar Ligand) |
|---|---|
| C=C(C)C1CC/C(C)=C\C1c2c(O)cc(CCCCC)cc2O | Oc1nc2cc3cc(CCCCC(=O)NC45C[C@@H]6C[C@@H](C[C@@H](C6)C4)C5)ccc3[nH]c2n1 |
|
|
|
|
|
|
| 00000001 43000008 20000102 00010202 00010000 40800000 02000001 00000602 00040900 00980842 08100000 40408840 00020002 00200000 00000400 00002008 00000000 02100020 00202000 00020a01 00000100 08000000 00008000 00400010 00200000 80000000 04404200 80000000 00000002 00024002 24020000 00010400 | 00014002 03005810 00184102 00010600 000c0040 0000c000 00008000 20000000 00400900 000808c0 08308004 40019000 0400880a 00e00000 60040140 000c000c 08000000 02000004 02202000 00000201 40020100 18048638 21800000 8050001c 00000000 80000000 00028040 10000000 00400002 00460003 c0060000 0c002680 |