On Target PRGR_HUMAN 0.59183675/CHEMBL48746
For the given ligand CBD, we have found in our database that, being scored 0.59183675, the most similar ligand is CHEMBL48746. Check out the elaboration below.
| CBD (Given Ligand) | CHEMBL48746 (Similar Ligand) |
|---|---|
| C=C(C)C1CC/C(C)=C\C1c2c(O)cc(CCCCC)cc2O | COc1cc(CC2C(=C)C=C(C)CC2(C)C)c(O)cc1Br |
|
|
|
|
|
|
| 00000001 43000008 20000102 00010202 00010000 40800000 02000001 00000602 00040900 00980842 08100000 40408840 00020002 00200000 00000400 00002008 00000000 02100020 00202000 00020a01 00000100 08000000 00008000 00400010 00200000 80000000 04404200 80000000 00000002 00024002 24020000 00010400 | 00004000 43048008 2000010a 00010200 40001000 40000001 02000000 00000603 00000800 00180842 08100002 40008040 00020012 20200001 01000401 00002008 00000000 02000420 00082000 00024201 00000100 08000000 00008000 00400012 00200000 80002000 045a4200 80000000 00000202 00064002 24020008 0a010400 |