On Target PGH2_HUMAN 0.5632184/CHEMBL1242095
For the given ligand CBD, we have found in our database that, being scored 0.5632184, the most similar ligand is CHEMBL1242095. Check out the elaboration below.
| CBD (Given Ligand) | CHEMBL1242095 (Similar Ligand) |
|---|---|
| C=C(C)C1CC/C(C)=C\C1c2c(O)cc(CCCCC)cc2O | CC(=CCC\C(=C\Cc1c(O)cc(O)c(C(=O)C)c1O)\C)C |
|
|
|
|
|
|
| 00000001 43000008 20000102 00010202 00010000 40800000 02000001 00000602 00040900 00980842 08100000 40408840 00020002 00200000 00000400 00002008 00000000 02100020 00202000 00020a01 00000100 08000000 00008000 00400010 00200000 80000000 04404200 80000000 00000002 00024002 24020000 00010400 | 00000001 01000808 20000101 00010202 00010001 00820000 02000001 00000602 00040000 00980a40 08000000 40408000 00028022 00000000 00000400 08082008 00000000 02100000 00200000 00020801 00000000 08020200 00008000 00400014 00200000 80000000 00524000 80800000 00000000 00020002 84000000 00000400 |