On Target ACE_HUMAN 0.2868217/CHEMBL55583
For the given ligand CBD, we have found in our database that, being scored 0.2868217, the most similar ligand is CHEMBL55583. Check out the elaboration below.
| CBD (Given Ligand) | CHEMBL55583 (Similar Ligand) |
|---|---|
| C=C(C)C1CC/C(C)=C\C1c2c(O)cc(CCCCC)cc2O | CCC(C)C(CC(S)Cc1ccccc1)C(=O)NC(Cc2ccc(O)cc2)C(=O)O |
|
|
|
|
|
|
| 00000001 43000008 20000102 00010202 00010000 40800000 02000001 00000602 00040900 00980842 08100000 40408840 00020002 00200000 00000400 00002008 00000000 02100020 00202000 00020a01 00000100 08000000 00008000 00400010 00200000 80000000 04404200 80000000 00000002 00024002 24020000 00010400 | 00010000 01005008 20100102 00110600 00000080 00000000 02000000 20000004 80200880 010908c0 08300000 4007b000 0600800a 00240000 80080000 00080008 10000000 02000000 00402008 00020201 00000100 18200e10 03000140 83500018 00000800 80000000 00120200 10000000 04000002 00060003 20024000 01012600 |