On Target MTOR_HUMAN 0.34166667/CHEMBL1797428
For the given ligand CBD, we have found in our database that, being scored 0.34166667, the most similar ligand is CHEMBL1797428. Check out the elaboration below.
| CBD (Given Ligand) | CHEMBL1797428 (Similar Ligand) |
|---|---|
| C=C(C)C1CC/C(C)=C\C1c2c(O)cc(CCCCC)cc2O | C[C@@H]1CC[C@@]2(CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)Cc6c[nH]nc6C(C)(C)[C@@H]5CC[C@@]34C)[C@@H]2[C@H]1C)C(=O)O |
|
|
|
|
|
|
| 00000001 43000008 20000102 00010202 00010000 40800000 02000001 00000602 00040900 00980842 08100000 40408840 00020002 00200000 00000400 00002008 00000000 02100020 00202000 00020a01 00000100 08000000 00008000 00400010 00200000 80000000 04404200 80000000 00000002 00024002 24020000 00010400 | 00010000 c3000008 20000182 00800210 01080100 40000002 00002000 00000603 00000800 001c0000 00108000 40003040 0c028008 00a00000 00000c20 000c200c 00000200 06000020 02402000 02222041 00100000 00000a00 0580c800 00000010 00202000 00000001 00524000 80000080 00000006 80024002 24020000 00000020 |