On Target PTGES_HUMAN 0.58/CHEMBL3608370
For the given ligand CBD, we have found in our database that, being scored 0.58, the most similar ligand is CHEMBL3608370. Check out the elaboration below.
| CBD (Given Ligand) | CHEMBL3608370 (Similar Ligand) |
|---|---|
| C=C(C)C1CC/C(C)=C\C1c2c(O)cc(CCCCC)cc2O | CC(C)C(C1=C(O)CC(C)(C)CC1=O)c2c(O)c(C(C(C)C)C3=C(O)CC(C)(C)CC3=O)c(O)c(C(C(C)C)C4=C(O)CC(C)(C)CC4=O)c2O |
|
|
|
|
|
|
| 00000001 43000008 20000102 00010202 00010000 40800000 02000001 00000602 00040900 00980842 08100000 40408840 00020002 00200000 00000400 00002008 00000000 02100020 00202000 00020a01 00000100 08000000 00008000 00400010 00200000 80000000 04404200 80000000 00000002 00024002 24020000 00010400 | 00010001 01000008 20000102 0001020a 00080001 00800000 06000081 00000602 01040800 00988840 08100000 40009040 84028022 00a00000 00000400 00082008 00000400 02100020 00652008 00020801 00000100 18000280 01008000 00400010 00200800 80000000 00524000 80800000 00004002 00024002 04020000 00000400 |