On Target PAR1_HUMAN 0.49295774/CHEMBL80672
For the given ligand tt, we have found in our database that, being scored 0.49295774, the most similar ligand is CHEMBL80672. Check out the elaboration below.
| tt (Given Ligand) | CHEMBL80672 (Similar Ligand) |
|---|---|
| N#C[C@@H]2C[C@@H]1C[C@@H]1N2C(=O)[C@@H](N)C45CC3CC(CC(O)(C3)C4)C5 | OC(=O)CCNC(=O)[C@@H]1CCCN(C1)C(=O)CCC2CCNCC2 |
|
|
|
|
|
|
| 00010000 01001000 00100000 00000400 00180000 00000010 00000000 20000000 00000000 00000080 00200000 50013000 0400802a 01800000 00000000 00080008 00400000 00000000 02402000 00000201 00000000 30040610 03000401 02100018 00000000 00000000 00000100 10000000 08000000 00040001 00020000 00002380 | 00010000 01001400 00100000 00000400 00000000 00000000 00000000 20000000 00000000 000001a0 00200000 50011000 0c00801a 00000000 00000000 00080008 00000000 00000001 00802010 00000201 00000000 101c0e30 01000080 00100018 00001001 00000000 00000000 10000000 00000000 00040011 00000000 00002200 |