On Target ACM4_HUMAN 0.44444445/CHEMBL479224
For the given ligand tt, we have found in our database that, being scored 0.44444445, the most similar ligand is CHEMBL479224. Check out the elaboration below.
| tt (Given Ligand) | CHEMBL479224 (Similar Ligand) |
|---|---|
| N#C[C@@H]2C[C@@H]1C[C@@H]1N2C(=O)[C@@H](N)C45CC3CC(CC(O)(C3)C4)C5 | CC(=O)NC(CCCNC(=N)N)C(=O)CCCCCCCCNC(=N)N |
|
|
|
|
|
|
| 00010000 01001000 00100000 00000400 00180000 00000010 00000000 20000000 00000000 00000080 00200000 50013000 0400802a 01800000 00000000 00080008 00400000 00000000 02402000 00000201 00000000 30040610 03000401 02100018 00000000 00000000 00000100 10000000 08000000 00040001 00020000 00002380 | 00010000 01001000 00100000 00000c00 00000000 00000000 00000000 20002000 00200200 00000082 00200000 40033000 0600901a 00000000 00000000 00100000 00000000 00000000 00002000 00000201 00000000 10050610 00000000 00100018 00000000 00000000 40000000 10000000 00000010 00040001 a00a4000 00000200 |