On Target NK1R_HUMAN 0.3888889/CHEMBL156933
For the given ligand tt, we have found in our database that, being scored 0.3888889, the most similar ligand is CHEMBL156933. Check out the elaboration below.
| tt (Given Ligand) | CHEMBL156933 (Similar Ligand) |
|---|---|
| N#C[C@@H]2C[C@@H]1C[C@@H]1N2C(=O)[C@@H](N)C45CC3CC(CC(O)(C3)C4)C5 | CCCCCN(CCCCC)C(=O)[C@H]1CCN([C@@H](C1)C(=O)O)C(=O)N(c2ccccc2)c3ccccc3 |
|
|
|
|
|
|
| 00010000 01001000 00100000 00000400 00180000 00000010 00000000 20000000 00000000 00000080 00200000 50013000 0400802a 01800000 00000000 00080008 00400000 00000000 02402000 00000201 00000000 30040610 03000401 02100018 00000000 00000000 00000100 10000000 08000000 00040001 00020000 00002380 | 00030016 01005000 00100000 00000e00 00080080 00000000 00000014 20002001 00202000 000208c0 00280004 5003b000 0600903a 01900000 80080040 00080008 30040000 00400000 08402002 00000201 40000100 18050e10 23022000 00100018 00110000 00000000 02000000 10000080 00008000 00060001 20084000 00806200 |