On Target DRD3_HUMAN 0.47435898/CHEMBL80571
For the given ligand tt, we have found in our database that, being scored 0.47435898, the most similar ligand is CHEMBL80571. Check out the elaboration below.
| tt (Given Ligand) | CHEMBL80571 (Similar Ligand) |
|---|---|
| N#C[C@@H]2C[C@@H]1C[C@@H]1N2C(=O)[C@@H](N)C45CC3CC(CC(O)(C3)C4)C5 | O=C(NC1CCC(CCN2CCN(CC2)c3ccccc3)CC1)C4CCCCC4 |
|
|
|
|
|
|
| 00010000 01001000 00100000 00000400 00180000 00000010 00000000 20000000 00000000 00000080 00200000 50013000 0400802a 01800000 00000000 00080008 00400000 00000000 02402000 00000201 00000000 30040610 03000401 02100018 00000000 00000000 00000100 10000000 08000000 00040001 00020000 00002380 | 00014002 01001000 00100020 04000600 00000000 00000000 00000000 20000000 00000000 00000ac0 00200004 40019000 0400800a 00002000 00000040 00000000 00040000 00000000 0a002000 00000201 40100000 38040610 20000021 0210001a 00000000 00000000 00000000 10000080 08008000 00060001 00020000 00002200 |