On Target OPRM_MOUSE 0.44329897/CHEMBL440765
For the given ligand tt, we have found in our database that, being scored 0.44329897, the most similar ligand is CHEMBL440765. Check out the elaboration below.
| tt (Given Ligand) | CHEMBL440765 (Similar Ligand) |
|---|---|
| N#C[C@@H]2C[C@@H]1C[C@@H]1N2C(=O)[C@@H](N)C45CC3CC(CC(O)(C3)C4)C5 | CN([C@H]1CC[C@@]2(CCCO2)C[C@@H]1N3CCCC3)C(=O)Cc4ccccc4 |
|
|
|
|
|
|
| 00010000 01001000 00100000 00000400 00180000 00000010 00000000 20000000 00000000 00000080 00200000 50013000 0400802a 01800000 00000000 00080008 00400000 00000000 02402000 00000201 00000000 30040610 03000401 02100018 00000000 00000000 00000100 10000000 08000000 00040001 00020000 00002380 | 00000040 01003000 00100100 04010700 00180000 00000010 00000000 20000008 00000080 000808c0 08200000 40019000 01008002 01882000 40080000 00081008 00a00000 02000000 02c02000 00000201 00000020 38240610 01000081 83500018 00000401 80000000 00000200 10000000 0c000200 00060003 00022000 00002e00 |