On Target NOS2_HUMAN 0.515625/CHEMBL7889
For the given ligand tt, we have found in our database that, being scored 0.515625, the most similar ligand is CHEMBL7889. Check out the elaboration below.
| tt (Given Ligand) | CHEMBL7889 (Similar Ligand) |
|---|---|
| N#C[C@@H]2C[C@@H]1C[C@@H]1N2C(=O)[C@@H](N)C45CC3CC(CC(O)(C3)C4)C5 | CC(=N)NCCCC[C@H](N)C(=O)O |
|
|
|
|
|
|
| 00010000 01001000 00100000 00000400 00180000 00000010 00000000 20000000 00000000 00000080 00200000 50013000 0400802a 01800000 00000000 00080008 00400000 00000000 02402000 00000201 00000000 30040610 03000401 02100018 00000000 00000000 00000100 10000000 08000000 00040001 00020000 00002380 | 00010000 01000000 00100000 00000400 00080000 00000000 00000000 20000000 00000200 00000083 00200000 40013000 0400800a 00800000 00000000 00180008 00000000 00000000 00402000 00000201 00000000 10000a30 03000000 00100010 00000000 00000000 40000000 10000000 00000010 00040000 80000000 00000200 |