On Target IKKB_HUMAN 0.2857143/CHEMBL1762621
For the given ligand tt, we have found in our database that, being scored 0.2857143, the most similar ligand is CHEMBL1762621. Check out the elaboration below.
| tt (Given Ligand) | CHEMBL1762621 (Similar Ligand) |
|---|---|
| N#C[C@@H]2C[C@@H]1C[C@@H]1N2C(=O)[C@@H](N)C45CC3CC(CC(O)(C3)C4)C5 | COC(=O)[C@]12CCC(C)(C)C[C@H]1[C@H]3C(=O)C=C4[C@@](C)(CC[C@H]5C(C)(C)C(=O)C(=C[C@]45C)C#N)[C@]3(C)CC2 |
|
|
|
|
|
|
| 00010000 01001000 00100000 00000400 00180000 00000010 00000000 20000000 00000000 00000080 00200000 50013000 0400802a 01800000 00000000 00080008 00400000 00000000 02402000 00000201 00000000 30040610 03000401 02100018 00000000 00000000 00000100 10000000 08000000 00040001 00020000 00002380 | 00010002 01000000 00000000 00090520 00080000 00080000 00000080 00000402 01000000 00128000 00000000 40009000 04028028 00800000 00000401 00080008 00c20000 00000020 02412000 00020001 00000001 10000a80 01008400 00000810 00200002 00000000 00404000 80000000 00080200 00040000 24020000 00000080 |