On Target PERM_HUMAN 0.295858/CHEMBL2346670
For the given ligand Glipizide, we have found in our database that, being scored 0.295858, the most similar ligand is CHEMBL2346670. Check out the elaboration below.
| Glipizide (Given Ligand) | CHEMBL2346670 (Similar Ligand) |
|---|---|
| Cc3cnc(C(=O)NCCc2ccc(S(=O)(=O)NC(=O)NC1CCCCC1)cc2)cn3 | CCN(CCc1c[nH]c2ccc(F)cc12)S(=O)(=O)C |
|
|
|
|
|
|
| 10000012 01801000 01100900 12b10e10 04000048 00100000 0800c000 00003005 10000080 000828d0 09292000 e0018400 00009002 08100041 80a20480 00040104 0a022000 02000002 02402000 00006201 80002000 18258e10 21004000 89500118 00140000 80000000 88000000 9000042c 04000404 20060803 a0080000 80010660 | 00000042 20000800 00100100 43310610 00041000 00000030 00012000 00000000 00400080 00490840 08202004 40008000 10000803 00401001 80000040 00040005 00000000 02000080 00200400 00104200 40000000 18208008 20800000 91400010 02042000 80000000 08000000 0000000d 04000000 00078002 00040200 00010660 |