On Target ACES_HUMAN 0.32512316/CHEMBL315515
For the given ligand Canagliflozin, we have found in our database that, being scored 0.32512316, the most similar ligand is CHEMBL315515. Check out the elaboration below.
| Canagliflozin (Given Ligand) | CHEMBL315515 (Similar Ligand) |
|---|---|
| Cc2ccc([C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)cc2Cc4ccc(c3ccc(F)cc3)s4 | [Br-].COc1cc2cc(sc2cc1OC)C(=O)CCC3CC[N+](C)(CC4CCCCO4)CC3 |
|
|
|
|
|
|
| 00012000 01800000 80100102 02050300 80a80051 10024010 00040480 0d102009 00000900 01480841 28100200 c0008a80 00000010 02a11000 00042000 020a9008 08020800 0200400a 15502000 50100005 00000920 680900a0 35004040 08400010 02000400 a4002000 00080800 40800265 020043ca 00068002 40020004 02c30600 | 00010040 11000808 2010010a 80010700 80081080 00800000 020000a0 20000010 00000800 00c808c0 08300200 d0019080 0400c03a 02a00000 01083089 00089008 11010000 02000028 00402000 00020205 00000920 580a0298 13000080 10500014 12000482 84000000 00000000 10000505 00000202 000e000a 88060008 00c12610 |