On Target TRPV1_RAT 0.38785046/CHEMBL500075
For the given ligand Glimepiride, we have found in our database that, being scored 0.38785046, the most similar ligand is CHEMBL500075. Check out the elaboration below.
| Glimepiride (Given Ligand) | CHEMBL500075 (Similar Ligand) |
|---|---|
| CC/C3=C(C)/CN(C(=O)NCCc2ccc(S(=O)(=O)NC(=O)N[C@@H]1CC[C@@H](C)CC1)cc2)C3=O | C[C@@H]1C[C@]2(OC3(Cc4ccccc4)O[C@@H]2[C@@H]5C=C(CNC(=O)Cc6ccc(NS(=O)(=O)C)cc6)C[C@@]7(O)[C@@H](C=C(C)C7=O)[C@@]15O3)C(=C)C |
|
|
|
|
|
|
| 00000010 01809000 01100100 02b10e00 00000048 08000000 08000004 20003404 01000000 011828c0 08202000 e0019400 04009102 00010041 80200000 00000000 22002008 02000500 02412040 00006201 80022100 18250710 00008000 89500018 00010000 88000000 80400000 1000052c 04000400 20060003 0c0a0000 00012660 | 00050052 81009800 00101902 c0b10700 00380040 00800004 02902a80 28000442 01200080 011808e8 08202204 4001d000 0502851a 02810001 c00c0444 002a9108 28800000 02000100 1741a010 0200e201 40110020 18241e90 2500a000 89500018 00200480 80200000 00484202 b401012c 04000200 80060003 2ca22000 02012e70 |