On Target FABP5_HUMAN 0.22142857/CHEMBL3957282
For the given ligand Glimepiride, we have found in our database that, being scored 0.22142857, the most similar ligand is CHEMBL3957282. Check out the elaboration below.
| Glimepiride (Given Ligand) | CHEMBL3957282 (Similar Ligand) |
|---|---|
| CC/C3=C(C)/CN(C(=O)NCCc2ccc(S(=O)(=O)NC(=O)N[C@@H]1CC[C@@H](C)CC1)cc2)C3=O | Cc1nsc(n1)c2c(C)c(sc2NC(=O)C3=C(CCC3)C(=O)O)C4CC4 |
|
|
|
|
|
|
| 00000010 01809000 01100100 02b10e00 00000048 08000000 08000004 20003404 01000000 011828c0 08202000 e0019400 04009102 00010041 80200000 00000000 22002008 02000500 02412040 00006201 80022100 18250710 00008000 89500018 00010000 88000000 80400000 1000052c 04000400 20060003 0c0a0000 00012660 | 0043c212 01028800 40100900 41001e02 64381002 00082540 c1088180 18a02770 01001901 00580093 04398304 e0011ce8 0f828118 01b18001 80123001 0038010e 61040000 16002118 38632018 01004005 00100908 5b080f90 6110e009 00534010 12045080 0c218e03 00c10010 90001484 00010114 222e0003 0c020800 00e50611 |