On Target PAR1_HUMAN 0.39455783/CHEMBL3658409
For the given ligand Glimepiride, we have found in our database that, being scored 0.39455783, the most similar ligand is CHEMBL3658409. Check out the elaboration below.
| Glimepiride (Given Ligand) | CHEMBL3658409 (Similar Ligand) |
|---|---|
| CC/C3=C(C)/CN(C(=O)NCCc2ccc(S(=O)(=O)NC(=O)N[C@@H]1CC[C@@H](C)CC1)cc2)C3=O | CCc1ccc(cc1)C2CC(CN(C2)C(=O)C3CCCC3)NC(=O)NC(C)(C)C |
|
|
|
|
|
|
| 00000010 01809000 01100100 02b10e00 00000048 08000000 08000004 20003404 01000000 011828c0 08202000 e0019400 04009102 00010041 80200000 00000000 22002008 02000500 02412040 00006201 80022100 18250710 00008000 89500018 00010000 88000000 80400000 1000052c 04000400 20060003 0c0a0000 00012660 | 00010000 01003200 00100102 04010e00 00000000 00000000 00000004 2000200c 00300980 000a08c0 08300000 50039800 0400b00a 00202000 00000000 00040000 00000010 02000000 00002040 00000201 00000100 38250610 00000001 83500018 00010000 80000000 00000000 10000000 0c000000 0106000b 00080000 00002600 |