On Target PAR1_HUMAN 0.38197425/CHEMBL308052
For the given ligand Glipizide, we have found in our database that, being scored 0.38197425, the most similar ligand is CHEMBL308052. Check out the elaboration below.
| Glipizide (Given Ligand) | CHEMBL308052 (Similar Ligand) |
|---|---|
| Cc3cnc(C(=O)NCCc2ccc(S(=O)(=O)NC(=O)NC1CCCCC1)cc2)cn3 | NCC[C@H](NC(=O)[C@H](Cc1ccc(F)c(F)c1)NC(=O)Nc2ccc3c(CN4CCCC4)cn(Cc5c(Cl)cccc5Cl)c3c2)C(=O)NCc6ccccn6 |
|
|
|
|
|
|
| 10000012 01801000 01100900 12b10e10 04000048 00100000 0800c000 00003005 10000080 000828d0 09292000 e0018400 00009002 08100041 80a20480 00040104 0a022000 02000002 02402000 00006201 80002000 18258e10 21004000 89500118 00140000 80000000 88000000 9000042c 04000404 20060803 a0080000 80010660 | 10038006 00803e00 00104100 16010e10 00041020 00100030 0000c004 2200300d 00300800 000b29c0 09390004 5003b800 0600b826 00503401 800204c0 02040104 00061818 82c00082 08200008 00100a01 c0000900 382f8f18 20826007 83500038 00156800 c0000200 880080c0 90000081 0c708104 0006801b 200cc200 80026660 |