On Target SC6A4_HUMAN 0.5117647/CHEMBL2012116
For the given ligand Canagliflozin, we have found in our database that, being scored 0.5117647, the most similar ligand is CHEMBL2012116. Check out the elaboration below.
| Canagliflozin (Given Ligand) | CHEMBL2012116 (Similar Ligand) |
|---|---|
| Cc2ccc([C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)cc2Cc4ccc(c3ccc(F)cc3)s4 | COC(=O)[C@H]1C2CCC(C[C@H]1c3ccc(s3)c4ccccc4)O2 |
|
|
|
|
|
|
| 00012000 01800000 80100102 02050300 80a80051 10024010 00040480 0d102009 00000900 01480841 28100200 c0008a80 00000010 02a11000 00042000 020a9008 08020800 0200400a 15502000 50100005 00000920 680900a0 35004040 08400010 02000400 a4002000 00080800 40800265 020043ca 00068002 40020004 02c30600 | 00012040 01000008 00000102 00010300 800c0040 10220000 020400a0 0c100008 00000900 01480841 00300200 c0009ea0 14008038 02a00000 00082000 00081008 00820002 02204008 05402008 10000005 00000920 58080a80 31000040 00400010 02400c00 84000000 00000800 00001744 0000420a 00060002 08020000 00c10410 |