On Target SC6A4_HUMAN 0.3888889/CHEMBL3216961
For the given ligand Glipizide, we have found in our database that, being scored 0.3888889, the most similar ligand is CHEMBL3216961. Check out the elaboration below.
| Glipizide (Given Ligand) | CHEMBL3216961 (Similar Ligand) |
|---|---|
| Cc3cnc(C(=O)NCCc2ccc(S(=O)(=O)NC(=O)NC1CCCCC1)cc2)cn3 | Cl.Cl.Cl.Cc1nc(C(=O)NCCCN2CCN(CC2)c3cccc(Cl)c3C)c(C)n1C4CCCC4 |
|
|
|
|
|
|
| 10000012 01801000 01100900 12b10e10 04000048 00100000 0800c000 00003005 10000080 000828d0 09292000 e0018400 00009002 08100041 80a20480 00040104 0a022000 02000002 02402000 00006201 80002000 18258e10 21004000 89500118 00140000 80000000 88000000 9000042c 04000404 20060803 a0080000 80010660 | 1000c002 01001400 00100120 15010e10 00080040 00108042 08004000 08003001 00000100 40001bf0 4029800c 40018800 02009006 00b02001 000204c0 000c0004 00260000 82000022 88400000 40004201 c0120000 380d0f10 21004021 0250011a 00042000 c1000600 00004010 90001080 08008005 01460811 e0080004 80028208 |