On Target MK01_HUMAN 0.33990148/CHEMBL1964937
For the given ligand Glimepiride, we have found in our database that, being scored 0.33990148, the most similar ligand is CHEMBL1964937. Check out the elaboration below.
| Glimepiride (Given Ligand) | CHEMBL1964937 (Similar Ligand) |
|---|---|
| CC/C3=C(C)/CN(C(=O)NCCc2ccc(S(=O)(=O)NC(=O)N[C@@H]1CC[C@@H](C)CC1)cc2)C3=O | OCC(NC(=O)N1CCC(=CC1)c2c[nH]c3ncccc23)c4ccccc4 |
|
|
|
|
|
|
| 00000010 01809000 01100100 02b10e00 00000048 08000000 08000004 20003404 01000000 011828c0 08202000 e0019400 04009102 00010041 80200000 00000000 22002008 02000500 02412040 00006201 80022100 18250710 00008000 89500018 00010000 88000000 80400000 1000052c 04000400 20060003 0c0a0000 00012660 | 00000012 0880da00 00104100 42810e10 000c12c4 00004000 80182284 22003400 00400900 015828c0 29300004 40008000 88009902 00c10800 00040042 004c000c 28004400 02000540 40220442 40800203 c0000100 1a058420 23808000 80400018 00052000 80000001 08482040 d0010100 00400100 0046040b 4c0c0200 800026a0 |