On Target HYES_HUMAN 0.54744524/CHEMBL3322802
For the given ligand Glimepiride, we have found in our database that, being scored 0.54744524, the most similar ligand is CHEMBL3322802. Check out the elaboration below.
| Glimepiride (Given Ligand) | CHEMBL3322802 (Similar Ligand) |
|---|---|
| CC/C3=C(C)/CN(C(=O)NCCc2ccc(S(=O)(=O)NC(=O)N[C@@H]1CC[C@@H](C)CC1)cc2)C3=O | CCCCCNC(=O)NCCCC\C=C/CCCCCCC(=O)NS(=O)(=O)c1ccccc1 |
|
|
|
|
|
|
| 00000010 01809000 01100100 02b10e00 00000048 08000000 08000004 20003404 01000000 011828c0 08202000 e0019400 04009102 00010041 80200000 00000000 22002008 02000500 02412040 00006201 80022100 18250710 00008000 89500018 00010000 88000000 80400000 1000052c 04000400 20060003 0c0a0000 00012660 | 00010010 01801000 01100000 01b00e00 00080000 00000000 00000004 00003402 00000000 005028c0 00202000 60019000 04029008 00000001 80600400 00000000 02002000 00000000 00412040 00006401 80000100 18050610 00008000 18500018 02210000 00000004 00404000 9000000c 00000400 20060001 240a0000 00010270 |