On Target AMPN_HUMAN 0.273743/CHEMBL1821980
For the given ligand Canagliflozin, we have found in our database that, being scored 0.273743, the most similar ligand is CHEMBL1821980. Check out the elaboration below.
| Canagliflozin (Given Ligand) | CHEMBL1821980 (Similar Ligand) |
|---|---|
| Cc2ccc([C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)cc2Cc4ccc(c3ccc(F)cc3)s4 | Cl.NC1CCc2c(Br)ccc(c2CC1=O)c3ccccc3 |
|
|
|
|
|
|
| 00012000 01800000 80100102 02050300 80a80051 10024010 00040480 0d102009 00000900 01480841 28100200 c0008a80 00000010 02a11000 00042000 020a9008 08020800 0200400a 15502000 50100005 00000920 680900a0 35004040 08400010 02000400 a4002000 00080800 40800265 020043ca 00068002 40020004 02c30600 | 00016000 11008201 00400102 00010600 04020001 00000002 00000000 00000001 40000800 000808c0 08100000 c000b200 05008010 00200000 60000220 02080008 01020000 02001000 04002000 00000001 00000330 18000200 11004000 00400010 00800020 80000181 00120000 00000041 00804002 0006000a 00022008 08420400 |