On Target AOFA_HUMAN 0.29285714/CHEMBL3415788
For the given ligand Glimepiride, we have found in our database that, being scored 0.29285714, the most similar ligand is CHEMBL3415788. Check out the elaboration below.
| Glimepiride (Given Ligand) | CHEMBL3415788 (Similar Ligand) |
|---|---|
| CC/C3=C(C)/CN(C(=O)NCCc2ccc(S(=O)(=O)NC(=O)N[C@@H]1CC[C@@H](C)CC1)cc2)C3=O | C[NH+](CC#C)CC(=C)CCc1ccccc1.OC(=O)C(=O)[O-] |
|
|
|
|
|
|
| 00000010 01809000 01100100 02b10e00 00000048 08000000 08000004 20003404 01000000 011828c0 08202000 e0019400 04009102 00010041 80200000 00000000 22002008 02000500 02412040 00006201 80022100 18250710 00008000 89500018 00010000 88000000 80400000 1000052c 04000400 20060003 0c0a0000 00012660 | 00000000 01000000 00100102 00010600 00402000 00000000 00000000 20100400 04100800 001808c2 08300000 4001c000 00008002 00210000 00100000 00080008 00000000 02000100 00000000 00000201 00000100 18000a00 04010000 00500010 00000000 80000000 00080000 90020000 00000000 00060002 04000020 00010600 |