On Target AOFA_HUMAN 0.27683616/CHEMBL3288293
For the given ligand Canagliflozin, we have found in our database that, being scored 0.27683616, the most similar ligand is CHEMBL3288293. Check out the elaboration below.
| Canagliflozin (Given Ligand) | CHEMBL3288293 (Similar Ligand) |
|---|---|
| Cc2ccc([C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)cc2Cc4ccc(c3ccc(F)cc3)s4 | Fc1ccc(COc2ccc3C(=O)CCCc3c2)cc1 |
|
|
|
|
|
|
| 00012000 01800000 80100102 02050300 80a80051 10024010 00040480 0d102009 00000900 01480841 28100200 c0008a80 00000010 02a11000 00042000 020a9008 08020800 0200400a 15502000 50100005 00000920 680900a0 35004040 08400010 02000400 a4002000 00080800 40800265 020043ca 00068002 40020004 02c30600 | 04010000 43000808 2010010b 02010200 00001000 4000c010 02040000 00000001 00000900 00080840 08100000 40009000 04808002 20211080 01000001 02080008 00000200 02000200 00082000 00120201 00400100 08020260 00004000 00c01014 00000000 80002001 00120000 00000001 00000202 00028002 c0000000 00400600 |