On Target ADRB2_HUMAN 0.34817815/CHEMBL1683942
For the given ligand Canagliflozin, we have found in our database that, being scored 0.34817815, the most similar ligand is CHEMBL1683942. Check out the elaboration below.
| Canagliflozin (Given Ligand) | CHEMBL1683942 (Similar Ligand) |
|---|---|
| Cc2ccc([C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)cc2Cc4ccc(c3ccc(F)cc3)s4 | C[N+]1(CCCCCCCCCNC[C@H](O)c2ccc(O)c3NC(=O)C=Cc23)[C@@H]4C[C@@H](C[C@@H]1[C@H]5O[C@@H]45)OC(=O)C(O)(c6cccs6)c7cccs7 |
|
|
|
|
|
|
| 00012000 01800000 80100102 02050300 80a80051 10024010 00040480 0d102009 00000900 01480841 28100200 c0008a80 00000010 02a11000 00042000 020a9008 08020800 0200400a 15502000 50100005 00000920 680900a0 35004040 08400010 02000400 a4002000 00080800 40800265 020043ca 00068002 40020004 02c30600 | 00010442 05000808 60104100 c0011701 002c40c0 0000c074 02000080 21202041 06420180 404808e0 0ca00204 d001d080 91008812 02e80000 401c3048 000c910c 18a20800 0200000a 14f02000 00220215 40012820 58288ab8 37900080 89501010 12002401 e4000000 00520240 d0001035 04000380 00060006 60862000 00c12660 |