On Target ADRB2_HUMAN 0.33990148/CHEMBL1814273
For the given ligand Sitagliptin, we have found in our database that, being scored 0.33990148, the most similar ligand is CHEMBL1814273. Check out the elaboration below.
| Sitagliptin (Given Ligand) | CHEMBL1814273 (Similar Ligand) |
|---|---|
| N[C@@H](CC(=O)N1CCn2c(C1)nnc2C(F)(F)F)Cc3cc(F)c(F)cc3F | CC(=O)O.OCc1cc(ccc1O)[C@@H](O)CNCCCCCCOCCCCc2cccc(CN3C(=O)CNC3=O)c2 |
|
|
|
|
|
|
| 00010040 01002408 40102102 02010e00 01100600 00100016 08800800 28002401 00100900 001929e0 08310120 d4019800 0c009006 04201000 00020800 0008200c 0100d200 020000a2 00400000 00b61a01 00000103 38232600 21000001 83500418 00010010 c0000400 c0400000 90021001 0c344004 00068013 84200080 00400e00 | 00010040 01802008 20100102 04010f00 00081081 00004000 12000004 22003808 00000980 000908c0 a9300000 4001a000 04008802 00a02000 00080400 00083008 10804000 02002000 00402440 40020201 80020120 38218e30 03000000 83500018 00000400 c0000000 08520000 90000000 0c000300 00060003 60044000 80002600 |