On Target GLRA3_HUMAN 0.13402061/CHEMBL4070615
For the given ligand Canagliflozin, we have found in our database that, being scored 0.13402061, the most similar ligand is CHEMBL4070615. Check out the elaboration below.
| Canagliflozin (Given Ligand) | CHEMBL4070615 (Similar Ligand) |
|---|---|
| Cc2ccc([C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)cc2Cc4ccc(c3ccc(F)cc3)s4 | C[C@H]1[C@@H]2[C@H](CN1S(=O)(=O)c3ccc4OCOc4c3)c5cnccc5N(C)C2=O |
|
|
|
|
|
|
| 00012000 01800000 80100102 02050300 80a80051 10024010 00040480 0d102009 00000900 01480841 28100200 c0008a80 00000010 02a11000 00042000 020a9008 08020800 0200400a 15502000 50100005 00000920 680900a0 35004040 08400010 02000400 a4002000 00080800 40800265 020043ca 00068002 40020004 02c30600 | 00020052 23804608 2110410a 01b00610 200c1700 00042050 0301a000 20040000 00600880 004909e0 40382034 60039000 0c00c803 10300801 81e20201 0024800e 000ce004 02000004 00680c18 00027e03 e0140300 18248600 20804000 99410018 42041800 0108000c 08828010 3000108c 05480600 20060a1b 00000080 20812670 |