On Target CASP1_HUMAN 0.33333334/CHEMBL1221597
For the given ligand Glimepiride, we have found in our database that, being scored 0.33333334, the most similar ligand is CHEMBL1221597. Check out the elaboration below.
| Glimepiride (Given Ligand) | CHEMBL1221597 (Similar Ligand) |
|---|---|
| CC/C3=C(C)/CN(C(=O)NCCc2ccc(S(=O)(=O)NC(=O)N[C@@H]1CC[C@@H](C)CC1)cc2)C3=O | CC(C)[C@H](CC(=O)NCCc1cccc2ccccc12)C(=O)N[C@@H](CC(=O)O)C=O |
|
|
|
|
|
|
| 00000010 01809000 01100100 02b10e00 00000048 08000000 08000004 20003404 01000000 011828c0 08202000 e0019400 04009102 00010041 80200000 00000000 22002008 02000500 02412040 00006201 80022100 18250710 00008000 89500018 00010000 88000000 80400000 1000052c 04000400 20060003 0c0a0000 00012660 | 00070000 01001000 00100100 00010600 00000000 00000000 00000000 20000004 00200080 000808c0 08200000 4003b000 0e008002 00000000 80000000 00080008 00000000 02000001 00c00010 00000201 00000000 18300e08 01000080 81500018 00001001 80000000 00000000 10000000 04000002 00060003 20004000 00802600 |