On Target CASP1_HUMAN 0.27894738/CHEMBL1222833
For the given ligand Canagliflozin, we have found in our database that, being scored 0.27894738, the most similar ligand is CHEMBL1222833. Check out the elaboration below.
| Canagliflozin (Given Ligand) | CHEMBL1222833 (Similar Ligand) |
|---|---|
| Cc2ccc([C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)cc2Cc4ccc(c3ccc(F)cc3)s4 | OC(=O)C[C@H](NC(=O)OCc1ccccc1)C(=O)COC(=O)CC(c2ccccc2)c3ccccc3 |
|
|
|
|
|
|
| 00012000 01800000 80100102 02050300 80a80051 10024010 00040480 0d102009 00000900 01480841 28100200 c0008a80 00000010 02a11000 00042000 020a9008 08020800 0200400a 15502000 50100005 00000920 680900a0 35004040 08400010 02000400 a4002000 00080800 40800265 020043ca 00068002 40020004 02c30600 | 01050040 01401008 00100100 00010700 00080000 0000c000 00000000 01000000 00000b00 00080840 08300000 4000f000 0c008020 02090000 00000000 0a1a1008 00a20000 82080401 00c00898 00000001 00000120 18100f30 010000c0 0040001c 00004c00 a0002002 00000000 40200000 00000282 00060007 e0004000 02000600 |