On Target PPAP_HUMAN 0.2/CHEMBL501717
For the given ligand Glipizide, we have found in our database that, being scored 0.2, the most similar ligand is CHEMBL501717. Check out the elaboration below.
| Glipizide (Given Ligand) | CHEMBL501717 (Similar Ligand) |
|---|---|
| Cc3cnc(C(=O)NCCc2ccc(S(=O)(=O)NC(=O)NC1CCCCC1)cc2)cn3 | Cl.C[C@@H](N[C@H](c1ccccc1)P(=O)(O)O)c2ccccc2 |
|
|
|
|
|
|
| 10000012 01801000 01100900 12b10e10 04000048 00100000 0800c000 00003005 10000080 000828d0 09292000 e0018400 00009002 08100041 80a20480 00040104 0a022000 02000002 02402000 00006201 80002000 18258e10 21004000 89500118 00140000 80000000 88000000 9000042c 04000404 20060803 a0080000 80010660 | 00010010 00000600 00000100 00010600 00000000 00400000 04000000 02001000 000000c0 00080840 08200000 40008000 00000802 00020000 8008040c 00000000 00003028 02000000 00000000 00000200 00000000 0d308000 00000000 00400010 00000000 c6010006 00000000 80014000 00000100 30060002 00040000 00028603 |