On Target PDE4B_HUMAN 0.33136094/CHEMBL35213
For the given ligand Glimepiride, we have found in our database that, being scored 0.33136094, the most similar ligand is CHEMBL35213. Check out the elaboration below.
| Glimepiride (Given Ligand) | CHEMBL35213 (Similar Ligand) |
|---|---|
| CC/C3=C(C)/CN(C(=O)NCCc2ccc(S(=O)(=O)NC(=O)N[C@@H]1CC[C@@H](C)CC1)cc2)C3=O | COc1ccc(cc1OC2CCCC2)C3CCN(C3)C(=O)NCc4ccccc4 |
|
|
|
|
|
|
| 00000010 01809000 01100100 02b10e00 00000048 08000000 08000004 20003404 01000000 011828c0 08202000 e0019400 04009102 00010041 80200000 00000000 22002008 02000500 02412040 00006201 80022100 18250710 00008000 89500018 00010000 88000000 80400000 1000052c 04000400 20060003 0c0a0000 00012660 | 04000000 43801208 20100108 00210f00 00081000 c2000010 02040004 02003004 00000880 000808c0 09300000 40008000 0080d802 20000080 11000001 020ca008 00804008 02000000 00480040 00020201 80000100 18258400 01000000 81400018 00010000 80000000 00120000 90000000 04000300 0106000b 000c0000 80000640 |