On Target ACM4_HUMAN 0.40101522/CHEMBL3545181
For the given ligand Canagliflozin, we have found in our database that, being scored 0.40101522, the most similar ligand is CHEMBL3545181. Check out the elaboration below.
| Canagliflozin (Given Ligand) | CHEMBL3545181 (Similar Ligand) |
|---|---|
| Cc2ccc([C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)cc2Cc4ccc(c3ccc(F)cc3)s4 | O.[Br-].C[N+]1(C)[C@@H]2C[C@H](C[C@H]1[C@@H]3O[C@H]23)OC(=O)C(O)(c4cccs4)c5cccs5 |
|
|
|
|
|
|
| 00012000 01800000 80100102 02050300 80a80051 10024010 00040480 0d102009 00000900 01480841 28100200 c0008a80 00000010 02a11000 00042000 020a9008 08020800 0200400a 15502000 50100005 00000920 680900a0 35004040 08400010 02000400 a4002000 00080800 40800265 020043ca 00068002 40020004 02c30600 | 00010440 05000000 00100100 80011701 002840c0 00004010 00000080 21002041 00020100 00480080 00a00200 d001d080 01008012 02880000 400c3008 00089108 18a20800 0200000a 14d02000 00000215 00012820 58080a90 17100080 08500010 12000401 24000000 00000200 d0001025 00000380 00060006 60822008 00c12640 |