On Target ACHA9_HUMAN 0.27876106/CHEMBL386114
For the given ligand Glipizide, we have found in our database that, being scored 0.27876106, the most similar ligand is CHEMBL386114. Check out the elaboration below.
| Glipizide (Given Ligand) | CHEMBL386114 (Similar Ligand) |
|---|---|
| Cc3cnc(C(=O)NCCc2ccc(S(=O)(=O)NC(=O)NC1CCCCC1)cc2)cn3 | C[C@H](NC(=O)[C@H](CS)NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@@H]1CCCN1C(=O)[C@H](CC(=O)O)NC(=O)[C@H](CO)NC(=O)[C@H](CS)NC(=O)[C@H](CS)NC(=O)CN)C(=O)N[C@@H](Cc2c[nH]c3ccccc23)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N |
|
|
|
|
|
|
| 10000012 01801000 01100900 12b10e10 04000048 00100000 0800c000 00003005 10000080 000828d0 09292000 e0018400 00009002 08100041 80a20480 00040104 0a022000 02000002 02402000 00006201 80002000 18258e10 21004000 89500118 00140000 80000000 88000000 9000042c 04000404 20060803 a0080000 80010660 | 00070002 01007a00 00100100 45910e10 00141282 00000010 00012000 2000000c 00600880 020f08c2 08300014 4003b000 1e008812 00442809 80180040 000c000c 10000800 02000001 00e00418 00400301 40000100 38348e28 23800283 97500018 00043801 80000000 48010000 10000000 0c000002 0006002b 20044200 03812e20 |