On Target DRD2_HUMAN 0.37438422/CHEMBL597900
For the given ligand Canagliflozin, we have found in our database that, being scored 0.37438422, the most similar ligand is CHEMBL597900. Check out the elaboration below.
| Canagliflozin (Given Ligand) | CHEMBL597900 (Similar Ligand) |
|---|---|
| Cc2ccc([C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)cc2Cc4ccc(c3ccc(F)cc3)s4 | CN1CCc2cc(Cl)c(O)cc2[C@@H]3[C@@H]1CCc4c3cccc4c5cccs5 |
|
|
|
|
|
|
| 00012000 01800000 80100102 02050300 80a80051 10024010 00040480 0d102009 00000900 01480841 28100200 c0008a80 00000010 02a11000 00042000 020a9008 08020800 0200400a 15502000 50100005 00000920 680900a0 35004040 08400010 02000400 a4002000 00080800 40800265 020043ca 00068002 40020004 02c30600 | 0001a000 47000209 20100102 00010e00 00021021 c0000002 06040480 29100009 04000880 000808c1 08310200 40808a80 02000036 00200000 a1002020 020c0008 00020200 0a101008 04102000 00020201 00000110 58200180 31004000 814b0010 02802000 a6000881 00160000 50008245 0600408a 0006000a 00000000 00c32600 |