On Target DRD2_HUMAN 0.42774567/CHEMBL122165
For the given ligand Sitagliptin, we have found in our database that, being scored 0.42774567, the most similar ligand is CHEMBL122165. Check out the elaboration below.
| Sitagliptin (Given Ligand) | CHEMBL122165 (Similar Ligand) |
|---|---|
| N[C@@H](CC(=O)N1CCn2c(C1)nnc2C(F)(F)F)Cc3cc(F)c(F)cc3F | OC(=O)\C=C\C(=O)O.Fc1cc(F)c2C(=O)C3(CCN(CCc4ccccc4)CC3)CCc2c1 |
|
|
|
|
|
|
| 00010040 01002408 40102102 02010e00 01100600 00100016 08800800 28002401 00100900 001929e0 08310120 d4019800 0c009006 04201000 00020800 0008200c 0100d200 020000a2 00400000 00b61a01 00000103 38232600 21000001 83500418 00010010 c0000400 c0400000 90021001 0c344004 00068013 84200080 00400e00 | 00030000 01000800 00100102 02010600 00000200 00008012 00000000 20000401 01100880 000928c0 08300000 d0019000 04008042 00201000 00200020 00080008 01000200 02000080 00212010 00100201 00400102 18220a50 00004000 81500014 00001000 80001001 80400000 10000001 04100002 00068002 84000000 00c02600 |