On Target HPGDS_HUMAN 0.26244345/CHEMBL3931600
For the given ligand Canagliflozin, we have found in our database that, being scored 0.26244345, the most similar ligand is CHEMBL3931600. Check out the elaboration below.
| Canagliflozin (Given Ligand) | CHEMBL3931600 (Similar Ligand) |
|---|---|
| Cc2ccc([C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)cc2Cc4ccc(c3ccc(F)cc3)s4 | C[C@H](NC(=O)c1ccc(nc1)c2cc(C)cs2)c3ccc4ccccc4c3 |
|
|
|
|
|
|
| 00012000 01800000 80100102 02050300 80a80051 10024010 00040480 0d102009 00000900 01480841 28100200 c0008a80 00000010 02a11000 00042000 020a9008 08020800 0200400a 15502000 50100005 00000920 680900a0 35004040 08400010 02000400 a4002000 00080800 40800265 020043ca 00068002 40020004 02c30600 | 10012002 00808800 00004900 50010610 00141020 00000000 000c4080 1a181008 00800300 10080851 09208204 40008280 8000881a 00000001 00023480 020c000c 0002a000 0200300c 04210000 30400001 c1000008 49048e88 30800000 0040011c 02040000 c4000000 08000040 80000245 0050411c 00060403 a0140800 80c10600 |