On Target HPGDS_HUMAN 0.41203704/CHEMBL3698264
For the given ligand Sitagliptin, we have found in our database that, being scored 0.41203704, the most similar ligand is CHEMBL3698264. Check out the elaboration below.
| Sitagliptin (Given Ligand) | CHEMBL3698264 (Similar Ligand) |
|---|---|
| N[C@@H](CC(=O)N1CCn2c(C1)nnc2C(F)(F)F)Cc3cc(F)c(F)cc3F | CC1C=CC=C1C(=O)N2CCN(CC2)C(=O)NC3CCN(CC3)c4ccc(CCCn5nc(C)nc5C)cc4 |
|
|
|
|
|
|
| 00010040 01002408 40102102 02010e00 01100600 00100016 08800800 28002401 00100900 001929e0 08310120 d4019800 0c009006 04201000 00020800 0008200c 0100d200 020000a2 00400000 00b61a01 00000103 38232600 21000001 83500418 00010010 c0000400 c0400000 90021001 0c344004 00068013 84200080 00400e00 | 00004006 0104be08 40100100 44010e00 61080000 0000a005 00900004 20002408 11100900 001a09e0 0834000c 50019800 0402b002 2081a000 000202c0 0008200c 2004c010 02000100 084900c0 02201201 e0100100 38092640 61008021 02500818 00010000 c0000000 00480000 90001080 0d008105 800e001b 84100080 00000708 |